C10H14O2 — CID 143993556
(3E,4E)-4-hydroxy-3-propylidenehepta-4,6-dien-2-one (PubChem CID 143993556) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (3E,4E)-4-hydroxy-3-propylidenehepta-4,6-dien-2-one.
| Compound Name | (3E,4E)-4-hydroxy-3-propylidenehepta-4,6-dien-2-one |
|---|---|
| PubChem CID | 143993556 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (3E,4E)-4-hydroxy-3-propylidenehepta-4,6-dien-2-one |
| SMILES | C=C/C=C(O)\C(=C/CC)C(C)=O |
| InChI | InChI=1S/C10H14O2/c1-4-6-9(8(3)11)10(12)7-5-2/h5-7,12H,2,4H2,1,3H3/b9-6-,10-7+ |
| InChIKey | VCZUKTHLVMMLEM-PCCLLEMOSA-N |
| XLogP | 2.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|