C9H12O2 — CID 90763748
2-buta-1,3-dien-2-ylpent-2-enoic acid (PubChem CID 90763748) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-ylpent-2-enoic acid.
| Compound Name | 2-buta-1,3-dien-2-ylpent-2-enoic acid |
|---|---|
| PubChem CID | 90763748 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 2-buta-1,3-dien-2-ylpent-2-enoic acid |
| SMILES | C=CC(=C)C(=CCC)C(=O)O |
| InChI | InChI=1S/C9H12O2/c1-4-6-8(9(10)11)7(3)5-2/h5-6H,2-4H2,1H3,(H,10,11) |
| InChIKey | CJGYLYDZVYUMGH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|