C12H23N3O — CID 167508056
(2E,3E)-3-amino-N-methyl-2-propylidenehexa-3,5-dienehydrazide;ethane (PubChem CID 167508056) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is (2E,3E)-3-amino-N-methyl-2-propylidenehexa-3,5-dienehydrazide;ethane.
| Compound Name | (2E,3E)-3-amino-N-methyl-2-propylidenehexa-3,5-dienehydrazide;ethane |
|---|---|
| PubChem CID | 167508056 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | (2E,3E)-3-amino-N-methyl-2-propylidenehexa-3,5-dienehydrazide;ethane |
| SMILES | C=C/C=C(N)\C(=C/CC)C(=O)N(C)N.CC |
| InChI | InChI=1S/C10H17N3O.C2H6/c1-4-6-8(9(11)7-5-2)10(14)13(3)12;1-2/h5-7H,2,4,11-12H2,1,3H3;1-2H3/b8-6+,9-7+; |
| InChIKey | BRGUMYTUHQGLPA-SLGVWIAZSA-N |
| XLogP | 1.71 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|