C23H38N4O2 — CID 145087367
2-[amino-[(2E,3E)-3-amino-2-prop-2-enylidenehexa-3,5-dienoyl]amino]-N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]acetamide;ethane (PubChem CID 145087367) has the molecular formula C23H38N4O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is 2-[amino-[(2E,3E)-3-amino-2-prop-2-enylidenehexa-3,5-dienoyl]amino]-N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]acetamide;ethane.
| Compound Name | 2-[amino-[(2E,3E)-3-amino-2-prop-2-enylidenehexa-3,5-dienoyl]amino]-N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]acetamide;ethane |
|---|---|
| PubChem CID | 145087367 |
| Molecular Formula | C23H38N4O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | 2-[amino-[(2E,3E)-3-amino-2-prop-2-enylidenehexa-3,5-dienoyl]amino]-N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]acetamide;ethane |
| SMILES | C=C/C=C\C(=C/C)CNC(=O)CN(N)C(=O)C(=C/C=C)/C(N)=C\C=C.CC.CC |
| InChI | InChI=1S/C19H26N4O2.2C2H6/c1-5-9-12-15(8-4)13-22-18(24)14-23(21)19(25)16(10-6-2)17(20)11-7-3;2*1-2/h5-12H,1-3,13-14,20-21H2,4H3,(H,22,24);2*1-2H3/b12-9-,15-8+,16-10+,17-11+;; |
| InChIKey | ZAFYSANXWFKNQE-AKJMKFJPSA-N |
| XLogP | 3.69 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|