C10H17N3O — CID 167508057
(2E,3E)-3-amino-N-methyl-2-propylidenehexa-3,5-dienehydrazide (PubChem CID 167508057) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is (2E,3E)-3-amino-N-methyl-2-propylidenehexa-3,5-dienehydrazide.
| Compound Name | (2E,3E)-3-amino-N-methyl-2-propylidenehexa-3,5-dienehydrazide |
|---|---|
| PubChem CID | 167508057 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (2E,3E)-3-amino-N-methyl-2-propylidenehexa-3,5-dienehydrazide |
| SMILES | C=C/C=C(N)\C(=C/CC)C(=O)N(C)N |
| InChI | InChI=1S/C10H17N3O/c1-4-6-8(9(11)7-5-2)10(14)13(3)12/h5-7H,2,4,11-12H2,1,3H3/b8-6+,9-7+ |
| InChIKey | DPMDOERVDKBEHN-CDJQDVQCSA-N |
| XLogP | 0.68 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|