C14H27NO2 — CID 111485934
(Z)-N-(2-ethyl-2-hydroxybutyl)-3,4,4-trimethylpent-2-enamide (PubChem CID 111485934) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is (Z)-N-(2-ethyl-2-hydroxybutyl)-3,4,4-trimethylpent-2-enamide.
| Compound Name | (Z)-N-(2-ethyl-2-hydroxybutyl)-3,4,4-trimethylpent-2-enamide |
|---|---|
| PubChem CID | 111485934 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | (Z)-N-(2-ethyl-2-hydroxybutyl)-3,4,4-trimethylpent-2-enamide |
| SMILES | CCC(O)(CC)CNC(=O)/C=C(/C)C(C)(C)C |
| InChI | InChI=1S/C14H27NO2/c1-7-14(17,8-2)10-15-12(16)9-11(3)13(4,5)6/h9,17H,7-8,10H2,1-6H3,(H,15,16)/b11-9- |
| InChIKey | BZJKZGQDHVWQCJ-LUAWRHEFSA-N |
| XLogP | 2.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|