C9H14N2O — CID 143480821
1-[[(2E)-2-(methylamino)penta-2,4-dienylidene]amino]propan-2-one (PubChem CID 143480821) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-[[(2E)-2-(methylamino)penta-2,4-dienylidene]amino]propan-2-one.
| Compound Name | 1-[[(2E)-2-(methylamino)penta-2,4-dienylidene]amino]propan-2-one |
|---|---|
| PubChem CID | 143480821 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1-[[(2E)-2-(methylamino)penta-2,4-dienylidene]amino]propan-2-one |
| SMILES | C=C/C=C(\C=N\CC(C)=O)NC |
| InChI | InChI=1S/C9H14N2O/c1-4-5-9(10-3)7-11-6-8(2)12/h4-5,7,10H,1,6H2,2-3H3/b9-5+,11-7+ |
| InChIKey | FIFNSMMSJDVUOV-TWHYHQCRSA-N |
| XLogP | 0.94 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|