C14H25NO2 — CID 142225178
butan-2-one;ethane;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]formamide (PubChem CID 142225178) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is butan-2-one;ethane;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]formamide.
| Compound Name | butan-2-one;ethane;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]formamide |
|---|---|
| PubChem CID | 142225178 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | butan-2-one;ethane;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]formamide |
| SMILES | C=C/C=C(\C=C/C)NC=O.CC.CCC(C)=O |
| InChI | InChI=1S/C8H11NO.C4H8O.C2H6/c1-3-5-8(6-4-2)9-7-10;1-3-4(2)5;1-2/h3-7H,1H2,2H3,(H,9,10);3H2,1-2H3;1-2H3/b6-4-,8-5+;; |
| InChIKey | VXAZWFDQIGKVAV-WGVBJJOMSA-N |
| XLogP | 3.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|