C7H11NS — CID 143724474
N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]thiohydroxylamine (PubChem CID 143724474) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]thiohydroxylamine.
| Compound Name | N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 143724474 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]thiohydroxylamine |
| SMILES | C=C/C=C(\C=C/C)NS |
| InChI | InChI=1S/C7H11NS/c1-3-5-7(8-9)6-4-2/h3-6,8-9H,1H2,2H3/b6-4-,7-5+ |
| InChIKey | XSYWDFWLNOVJPV-XGXWUAJZSA-N |
| XLogP | 2.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|