C9H14O — CID 87112963
(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-ol (PubChem CID 87112963) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-ol.
| Compound Name | (3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 87112963 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-ol |
| SMILES | C=C/C=C(\C=C/C)C(C)O |
| InChI | InChI=1S/C9H14O/c1-4-6-9(7-5-2)8(3)10/h4-8,10H,1H2,2-3H3/b7-5-,9-6+ |
| InChIKey | OOVMNMYGSQTCIL-XCZNYUDNSA-N |
| XLogP | 2.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|