C18H32 — CID 143201659
ethane;(3E,6E,7Z)-4-ethenyl-6-ethylidene-5-methylnona-1,3,7-triene (PubChem CID 143201659) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is ethane;(3E,6E,7Z)-4-ethenyl-6-ethylidene-5-methylnona-1,3,7-triene.
| Compound Name | ethane;(3E,6E,7Z)-4-ethenyl-6-ethylidene-5-methylnona-1,3,7-triene |
|---|---|
| PubChem CID | 143201659 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | ethane;(3E,6E,7Z)-4-ethenyl-6-ethylidene-5-methylnona-1,3,7-triene |
| SMILES | C=C/C=C(\C=C)C(C)C(/C=C\C)=C/C.CC.CC |
| InChI | InChI=1S/C14H20.2C2H6/c1-6-10-13(8-3)12(5)14(9-4)11-7-2;2*1-2/h6-12H,1,3H2,2,4-5H3;2*1-2H3/b11-7-,13-10+,14-9+;; |
| InChIKey | OSRSTKXLJZNGIA-ATVFJJMGSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|