C19H32 — CID 143745715
(3Z,5E,7E)-5-ethylidene-6-methyl-7-[(Z)-prop-1-enyl]deca-1,3,7-triene;propane (PubChem CID 143745715) has the molecular formula C19H32 and a molecular weight of 260.46 g/mol. Its IUPAC name is (3Z,5E,7E)-5-ethylidene-6-methyl-7-[(Z)-prop-1-enyl]deca-1,3,7-triene;propane.
| Compound Name | (3Z,5E,7E)-5-ethylidene-6-methyl-7-[(Z)-prop-1-enyl]deca-1,3,7-triene;propane |
|---|---|
| PubChem CID | 143745715 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | (3Z,5E,7E)-5-ethylidene-6-methyl-7-[(Z)-prop-1-enyl]deca-1,3,7-triene;propane |
| SMILES | C=C/C=C\C(=C/C)C(C)C(/C=C\C)=C/CC.CCC |
| InChI | InChI=1S/C16H24.C3H8/c1-6-10-13-15(9-4)14(5)16(11-7-2)12-8-3;1-3-2/h6-7,9-14H,1,8H2,2-5H3;3H2,1-2H3/b11-7-,13-10-,15-9+,16-12+; |
| InChIKey | FCCVFVVLFAYZKS-JTZZFUSGSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|