C11H19I — CID 173447281
3-iodohex-3-ene;penta-1,3-diene (PubChem CID 173447281) has the molecular formula C11H19I and a molecular weight of 278.18 g/mol. Its IUPAC name is 3-iodohex-3-ene;penta-1,3-diene.
| Compound Name | 3-iodohex-3-ene;penta-1,3-diene |
|---|---|
| PubChem CID | 173447281 |
| Molecular Formula | C11H19I |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 3-iodohex-3-ene;penta-1,3-diene |
| SMILES | C=CC=CC.CCC=C(I)CC |
| InChI | InChI=1S/C6H11I.C5H8/c1-3-5-6(7)4-2;1-3-5-4-2/h5H,3-4H2,1-2H3;3-5H,1H2,2H3 |
| InChIKey | DUUKJZWCRVEIOM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|