C11H21NO — CID 143504833
butane;(2E)-N,2-dimethylpenta-2,4-dienamide (PubChem CID 143504833) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is butane;(2E)-N,2-dimethylpenta-2,4-dienamide.
| Compound Name | butane;(2E)-N,2-dimethylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 143504833 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | butane;(2E)-N,2-dimethylpenta-2,4-dienamide |
| SMILES | C=C/C=C(\C)C(=O)NC.CCCC |
| InChI | InChI=1S/C7H11NO.C4H10/c1-4-5-6(2)7(9)8-3;1-3-4-2/h4-5H,1H2,2-3H3,(H,8,9);3-4H2,1-2H3/b6-5+; |
| InChIKey | BPBSLZIEIPTIGZ-IPZCTEOASA-N |
| XLogP | 2.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|