C8H14N2O2 — CID 87791357
(E)-N'-ethyl-N,2-dimethylbut-2-enediamide (PubChem CID 87791357) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is (E)-N'-ethyl-N,2-dimethylbut-2-enediamide.
| Compound Name | (E)-N'-ethyl-N,2-dimethylbut-2-enediamide |
|---|---|
| PubChem CID | 87791357 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (E)-N'-ethyl-N,2-dimethylbut-2-enediamide |
| SMILES | CCNC(=O)/C=C(\C)C(=O)NC |
| InChI | InChI=1S/C8H14N2O2/c1-4-10-7(11)5-6(2)8(12)9-3/h5H,4H2,1-3H3,(H,9,12)(H,10,11)/b6-5+ |
| InChIKey | RZPQDYYMALDNRO-AATRIKPKSA-N |
| XLogP | -0.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|