C13H25NO — CID 4562078
N,2-dimethylundec-2-enamide (PubChem CID 4562078) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is N,2-dimethylundec-2-enamide.
| Compound Name | N,2-dimethylundec-2-enamide |
|---|---|
| PubChem CID | 4562078 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | N,2-dimethylundec-2-enamide |
| SMILES | CCCCCCCCC=C(C)C(=O)NC |
| InChI | InChI=1S/C13H25NO/c1-4-5-6-7-8-9-10-11-12(2)13(15)14-3/h11H,4-10H2,1-3H3,(H,14,15) |
| InChIKey | PLYIQEYDPNMHPD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|