C9H14N2O — CID 145305765
(E)-N,2-dimethyl-4-prop-1-en-2-yliminobut-2-enamide (PubChem CID 145305765) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (E)-N,2-dimethyl-4-prop-1-en-2-yliminobut-2-enamide.
| Compound Name | (E)-N,2-dimethyl-4-prop-1-en-2-yliminobut-2-enamide |
|---|---|
| PubChem CID | 145305765 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (E)-N,2-dimethyl-4-prop-1-en-2-yliminobut-2-enamide |
| SMILES | C=C(C)/N=C/C=C(\C)C(=O)NC |
| InChI | InChI=1S/C9H14N2O/c1-7(2)11-6-5-8(3)9(12)10-4/h5-6H,1H2,2-4H3,(H,10,12)/b8-5+,11-6+ |
| InChIKey | HNJVQCAMPASCHH-XSIURBDDSA-N |
| XLogP | 1.28 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|