C6H10N2OS — CID 142896016
(Z)-3-(methanethioylamino)-N,2-dimethylprop-2-enamide (PubChem CID 142896016) has the molecular formula C6H10N2OS and a molecular weight of 158.23 g/mol. Its IUPAC name is (Z)-3-(methanethioylamino)-N,2-dimethylprop-2-enamide.
| Compound Name | (Z)-3-(methanethioylamino)-N,2-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 142896016 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | (Z)-3-(methanethioylamino)-N,2-dimethylprop-2-enamide |
| SMILES | CNC(=O)/C(C)=C\NC=S |
| InChI | InChI=1S/C6H10N2OS/c1-5(3-8-4-10)6(9)7-2/h3-4H,1-2H3,(H,7,9)(H,8,10)/b5-3- |
| InChIKey | FHKPCWDUIUXXRY-HYXAFXHYSA-N |
| XLogP | 0.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|