C27H39N5O2S — CID 143535466
(2Z,7Z)-8-[4-[2-(dimethylamino)ethoxy]phenyl]-7-methyl-6-methylidene-3-propyl-1,2,4-thiadiazocin-5-amine;(2Z)-N,2-dimethylpenta-2,4-dienamide (PubChem CID 143535466) has the molecular formula C27H39N5O2S and a molecular weight of 497.71 g/mol. Its IUPAC name is (2Z,7Z)-8-[4-[2-(dimethylamino)ethoxy]phenyl]-7-methyl-6-methylidene-3-propyl-1,2,4-thiadiazocin-5-amine;(2Z)-N,2-dimethylpenta-2,4-dienamide.
| Compound Name | (2Z,7Z)-8-[4-[2-(dimethylamino)ethoxy]phenyl]-7-methyl-6-methylidene-3-propyl-1,2,4-thiadiazocin-5-amine;(2Z)-N,2-dimethylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 143535466 |
| Molecular Formula | C27H39N5O2S |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | (2Z,7Z)-8-[4-[2-(dimethylamino)ethoxy]phenyl]-7-methyl-6-methylidene-3-propyl-1,2,4-thiadiazocin-5-amine;(2Z)-N,2-dimethylpenta-2,4-dienamide |
| SMILES | C=C/C=C(/C)C(=O)NC.C=C1/C(C)=C(/c2ccc(OCCN(C)C)cc2)S/N=C(CCC)\N=C/1N |
| InChI | InChI=1S/C20H28N4OS.C7H11NO/c1-6-7-18-22-20(21)15(3)14(2)19(26-23-18)16-8-10-17(11-9-16)25-13-12-24(4)5;1-4-5-6(2)7(9)8-3/h8-11H,3,6-7,12-13H2,1-2,4-5H3,(H2,21,22,23);4-5H,1H2,2-3H3,(H,8,9)/b19-14-;6-5- |
| InChIKey | NJCLLEHFBBNLCK-YOCKDFCLSA-N |
| XLogP | 5.00 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|