C21H30N3O3S+ — CID 143480807
(E)-4-ethenyl-6-(2-oxopropylimino)hex-4-en-3-one;[(2E)-3-(methylcarbamothioyl)penta-2,4-dienylidene]-(2-oxopropyl)azanium (PubChem CID 143480807) has the molecular formula C21H30N3O3S+ and a molecular weight of 404.56 g/mol. Its IUPAC name is (E)-4-ethenyl-6-(2-oxopropylimino)hex-4-en-3-one;[(2E)-3-(methylcarbamothioyl)penta-2,4-dienylidene]-(2-oxopropyl)azanium.
| Compound Name | (E)-4-ethenyl-6-(2-oxopropylimino)hex-4-en-3-one;[(2E)-3-(methylcarbamothioyl)penta-2,4-dienylidene]-(2-oxopropyl)azanium |
|---|---|
| PubChem CID | 143480807 |
| Molecular Formula | C21H30N3O3S+ |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (E)-4-ethenyl-6-(2-oxopropylimino)hex-4-en-3-one;[(2E)-3-(methylcarbamothioyl)penta-2,4-dienylidene]-(2-oxopropyl)azanium |
| SMILES | C=C/C(=C\C=N\CC(C)=O)C(=O)CC.C=C/C(=C\C=[NH+]\CC(C)=O)C(=S)NC |
| InChI | InChI=1S/C11H15NO2.C10H14N2OS/c1-4-10(11(14)5-2)6-7-12-8-9(3)13;1-4-9(10(14)11-3)5-6-12-7-8(2)13/h4,6-7H,1,5,8H2,2-3H3;4-6H,1,7H2,2-3H3,(H,11,14)/p+1/b10-6+,12-7+;9-5+,12-6+ |
| InChIKey | WHYREQAQXZFEJS-RDDZLRESSA-O |
| XLogP | 1.12 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|