C9H13N2O2+ — CID 143480865
[(2E)-2-carbamoylpenta-2,4-dienylidene]-(2-oxopropyl)azanium (PubChem CID 143480865) has the molecular formula C9H13N2O2+ and a molecular weight of 181.21 g/mol. Its IUPAC name is [(2E)-2-carbamoylpenta-2,4-dienylidene]-(2-oxopropyl)azanium.
| Compound Name | [(2E)-2-carbamoylpenta-2,4-dienylidene]-(2-oxopropyl)azanium |
|---|---|
| PubChem CID | 143480865 |
| Molecular Formula | C9H13N2O2+ |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | [(2E)-2-carbamoylpenta-2,4-dienylidene]-(2-oxopropyl)azanium |
| SMILES | C=C/C=C(\C=[NH+]\CC(C)=O)C(N)=O |
| InChI | InChI=1S/C9H12N2O2/c1-3-4-8(9(10)13)6-11-5-7(2)12/h3-4,6H,1,5H2,2H3,(H2,10,13)/p+1/b8-4+,11-6+ |
| InChIKey | YJEXSZAPKHKAPA-QAGITQMBSA-O |
| XLogP | -1.68 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|