C9H14N3O2+ — CID 143480823
[(2Z)-3-amino-2-carbamoylpenta-2,4-dienylidene]-(2-oxopropyl)azanium (PubChem CID 143480823) has the molecular formula C9H14N3O2+ and a molecular weight of 196.23 g/mol. Its IUPAC name is [(2Z)-3-amino-2-carbamoylpenta-2,4-dienylidene]-(2-oxopropyl)azanium.
| Compound Name | [(2Z)-3-amino-2-carbamoylpenta-2,4-dienylidene]-(2-oxopropyl)azanium |
|---|---|
| PubChem CID | 143480823 |
| Molecular Formula | C9H14N3O2+ |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | [(2Z)-3-amino-2-carbamoylpenta-2,4-dienylidene]-(2-oxopropyl)azanium |
| SMILES | C=C/C(N)=C(\C=[NH+]\CC(C)=O)C(N)=O |
| InChI | InChI=1S/C9H13N3O2/c1-3-8(10)7(9(11)14)5-12-4-6(2)13/h3,5H,1,4,10H2,2H3,(H2,11,14)/p+1/b8-7-,12-5+ |
| InChIKey | STQVWVSDRUXXCS-KRMQVSRUSA-O |
| XLogP | -2.39 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|