C9H13NO — CID 156794356
(4Z)-5-amino-4-ethenylhepta-4,6-dien-3-one (PubChem CID 156794356) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (4Z)-5-amino-4-ethenylhepta-4,6-dien-3-one.
| Compound Name | (4Z)-5-amino-4-ethenylhepta-4,6-dien-3-one |
|---|---|
| PubChem CID | 156794356 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (4Z)-5-amino-4-ethenylhepta-4,6-dien-3-one |
| SMILES | C=C/C(N)=C(\C=C)C(=O)CC |
| InChI | InChI=1S/C9H13NO/c1-4-7(8(10)5-2)9(11)6-3/h4-5H,1-2,6,10H2,3H3/b8-7- |
| InChIKey | DSGAMVJYLRYRLO-FPLPWBNLSA-N |
| XLogP | 1.55 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|