About dihydroxy(oxo)silane;pent-4-en-2-one
dihydroxy(oxo)silane;pent-4-en-2-one (PubChem CID 88814278) has the molecular formula C5H10O4Si
and a molecular weight of 162.22 g/mol. Its IUPAC name is dihydroxy(oxo)silane;pent-4-en-2-one.
Molecular Properties
| Compound Name | dihydroxy(oxo)silane;pent-4-en-2-one |
| PubChem CID | 88814278 |
| Molecular Formula | C5H10O4Si |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | dihydroxy(oxo)silane;pent-4-en-2-one |
| SMILES | C=CCC(C)=O.O=[Si](O)O |
| InChI | InChI=1S/C5H8O.H2O3Si/c1-3-4-5(2)6;1-4(2)3/h3H,1,4H2,2H3;1-2H |
| InChIKey | IAOXIZAHCURIMY-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)silane;pent-4-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)silane;pent-4-en-2-one?
The IUPAC name of dihydroxy(oxo)silane;pent-4-en-2-one (CID 88814278) is dihydroxy(oxo)silane;pent-4-en-2-one.
What is the SMILES notation for dihydroxy(oxo)silane;pent-4-en-2-one?
The canonical SMILES for dihydroxy(oxo)silane;pent-4-en-2-one is C=CCC(C)=O.O=[Si](O)O.
What is the InChIKey of dihydroxy(oxo)silane;pent-4-en-2-one?
The InChIKey is IAOXIZAHCURIMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O.H2O3Si/c1-3-4-5(2)6;1-4(2)3/h3H,1,4H2,2H3;1-2H.
What are the key properties of dihydroxy(oxo)silane;pent-4-en-2-one?
dihydroxy(oxo)silane;pent-4-en-2-one has a molecular weight of 162.22 g/mol, XLogP of -0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)silane;pent-4-en-2-one is sourced from PubChem (CID 88814278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).