C18H22N2O5+2 — CID 145339205
[(2E)-3-[(E)-2-ethenyl-4-(2-oxopropylazaniumylidene)but-2-enoyl]oxycarbonylpenta-2,4-dienylidene]-(2-oxopropyl)azanium (PubChem CID 145339205) has the molecular formula C18H22N2O5+2 and a molecular weight of 346.38 g/mol. Its IUPAC name is [(2E)-3-[(E)-2-ethenyl-4-(2-oxopropylazaniumylidene)but-2-enoyl]oxycarbonylpenta-2,4-dienylidene]-(2-oxopropyl)azanium.
| Compound Name | [(2E)-3-[(E)-2-ethenyl-4-(2-oxopropylazaniumylidene)but-2-enoyl]oxycarbonylpenta-2,4-dienylidene]-(2-oxopropyl)azanium |
|---|---|
| PubChem CID | 145339205 |
| Molecular Formula | C18H22N2O5+2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | [(2E)-3-[(E)-2-ethenyl-4-(2-oxopropylazaniumylidene)but-2-enoyl]oxycarbonylpenta-2,4-dienylidene]-(2-oxopropyl)azanium |
| SMILES | C=C/C(=C\C=[NH+]\CC(C)=O)C(=O)OC(=O)/C(C=C)=C/C=[NH+]/CC(C)=O |
| InChI | InChI=1S/C18H20N2O5/c1-5-15(7-9-19-11-13(3)21)17(23)25-18(24)16(6-2)8-10-20-12-14(4)22/h5-10H,1-2,11-12H2,3-4H3/p+2/b15-7+,16-8+,19-9+,20-10+ |
| InChIKey | HODGKZMFDZZKOY-BGXAMZFYSA-P |
| XLogP | -2.24 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|