C10H13NO3 — CID 142213114
(propanoylamino) (2E)-2-ethenylpenta-2,4-dienoate (PubChem CID 142213114) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is (propanoylamino) (2E)-2-ethenylpenta-2,4-dienoate.
| Compound Name | (propanoylamino) (2E)-2-ethenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 142213114 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (propanoylamino) (2E)-2-ethenylpenta-2,4-dienoate |
| SMILES | C=C/C=C(\C=C)C(=O)ONC(=O)CC |
| InChI | InChI=1S/C10H13NO3/c1-4-7-8(5-2)10(13)14-11-9(12)6-3/h4-5,7H,1-2,6H2,3H3,(H,11,12)/b8-7+ |
| InChIKey | MVNXMZYSNMNCKH-BQYQJAHWSA-N |
| XLogP | 1.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|