C18H30O2 — CID 167019416
(2-butyl-2-methylhexyl) (2E)-2-ethenylpenta-2,4-dienoate (PubChem CID 167019416) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (2-butyl-2-methylhexyl) (2E)-2-ethenylpenta-2,4-dienoate.
| Compound Name | (2-butyl-2-methylhexyl) (2E)-2-ethenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 167019416 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (2-butyl-2-methylhexyl) (2E)-2-ethenylpenta-2,4-dienoate |
| SMILES | C=C/C=C(\C=C)C(=O)OCC(C)(CCCC)CCCC |
| InChI | InChI=1S/C18H30O2/c1-6-10-13-18(5,14-11-7-2)15-20-17(19)16(9-4)12-8-3/h8-9,12H,3-4,6-7,10-11,13-15H2,1-2,5H3/b16-12+ |
| InChIKey | MGQPEWVDBKQVLW-FOWTUZBSSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|