C15H28F2O — CID 164918182
ethane;(4E,6Z)-4-ethenyl-3,3-difluoro-2-methylocta-4,6-dien-2-ol (PubChem CID 164918182) has the molecular formula C15H28F2O and a molecular weight of 262.38 g/mol. Its IUPAC name is ethane;(4E,6Z)-4-ethenyl-3,3-difluoro-2-methylocta-4,6-dien-2-ol.
| Compound Name | ethane;(4E,6Z)-4-ethenyl-3,3-difluoro-2-methylocta-4,6-dien-2-ol |
|---|---|
| PubChem CID | 164918182 |
| Molecular Formula | C15H28F2O |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | ethane;(4E,6Z)-4-ethenyl-3,3-difluoro-2-methylocta-4,6-dien-2-ol |
| SMILES | C=C/C(=C\C=C/C)C(F)(F)C(C)(C)O.CC.CC |
| InChI | InChI=1S/C11H16F2O.2C2H6/c1-5-7-8-9(6-2)11(12,13)10(3,4)14;2*1-2/h5-8,14H,2H2,1,3-4H3;2*1-2H3/b7-5-,9-8+;; |
| InChIKey | GUAMYPZVXDDXKF-TXRYRNSRSA-N |
| XLogP | 5.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|