C15H18F6O2 — CID 129145664
2-[[(3E,5E)-3-ethenyl-2-methylocta-3,5,7-trien-2-yl]oxymethyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 129145664) has the molecular formula C15H18F6O2 and a molecular weight of 344.30 g/mol. Its IUPAC name is 2-[[(3E,5E)-3-ethenyl-2-methylocta-3,5,7-trien-2-yl]oxymethyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[[(3E,5E)-3-ethenyl-2-methylocta-3,5,7-trien-2-yl]oxymethyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 129145664 |
| Molecular Formula | C15H18F6O2 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-[[(3E,5E)-3-ethenyl-2-methylocta-3,5,7-trien-2-yl]oxymethyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | C=C/C=C/C=C(\C=C)C(C)(C)OCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H18F6O2/c1-5-7-8-9-11(6-2)12(3,4)23-10-13(22,14(16,17)18)15(19,20)21/h5-9,22H,1-2,10H2,3-4H3/b8-7+,11-9+ |
| InChIKey | WYEZMEIYYIWTJM-MFDVASPDSA-N |
| XLogP | 4.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|