C15H25N — CID 138630940
(5E,7Z)-5-ethenyl-2,4,4-trimethyldeca-5,7,9-trien-2-amine (PubChem CID 138630940) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is (5E,7Z)-5-ethenyl-2,4,4-trimethyldeca-5,7,9-trien-2-amine.
| Compound Name | (5E,7Z)-5-ethenyl-2,4,4-trimethyldeca-5,7,9-trien-2-amine |
|---|---|
| PubChem CID | 138630940 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | (5E,7Z)-5-ethenyl-2,4,4-trimethyldeca-5,7,9-trien-2-amine |
| SMILES | C=C/C=C\C=C(/C=C)C(C)(C)CC(C)(C)N |
| InChI | InChI=1S/C15H25N/c1-7-9-10-11-13(8-2)14(3,4)12-15(5,6)16/h7-11H,1-2,12,16H2,3-6H3/b10-9-,13-11+ |
| InChIKey | OAEJCQACLDNREI-AZQRDTPRSA-N |
| XLogP | 3.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|