C13H17NO — CID 129201664
(3E,7Z)-5-amino-4-ethenyl-6-methylidenedeca-1,3,7,9-tetraen-5-ol (PubChem CID 129201664) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is (3E,7Z)-5-amino-4-ethenyl-6-methylidenedeca-1,3,7,9-tetraen-5-ol.
| Compound Name | (3E,7Z)-5-amino-4-ethenyl-6-methylidenedeca-1,3,7,9-tetraen-5-ol |
|---|---|
| PubChem CID | 129201664 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (3E,7Z)-5-amino-4-ethenyl-6-methylidenedeca-1,3,7,9-tetraen-5-ol |
| SMILES | C=C/C=C\C(=C)C(N)(O)/C(C=C)=C/C=C |
| InChI | InChI=1S/C13H17NO/c1-5-8-10-11(4)13(14,15)12(7-3)9-6-2/h5-10,15H,1-4,14H2/b10-8-,12-9+ |
| InChIKey | OKMUFUWJJKINDM-XXBUAHSKSA-N |
| XLogP | 2.23 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|