C6H7Br — CID 91549125
2-bromohexa-1,3,5-triene (PubChem CID 91549125) has the molecular formula C6H7Br and a molecular weight of 159.03 g/mol. Its IUPAC name is 2-bromohexa-1,3,5-triene.
| Compound Name | 2-bromohexa-1,3,5-triene |
|---|---|
| PubChem CID | 91549125 |
| Molecular Formula | C6H7Br |
| Molecular Weight | 159.03 g/mol |
| Exact Mass | 157.97 |
| IUPAC Name | 2-bromohexa-1,3,5-triene |
| SMILES | C=CC=CC(=C)Br |
| InChI | InChI=1S/C6H7Br/c1-3-4-5-6(2)7/h3-5H,1-2H2 |
| InChIKey | PBAQKDSFNGFYRL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.03 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|