C6H7NaS — CID 145184623
sodium (3Z)-hexa-1,3,5-triene-2-thiolate (PubChem CID 145184623) has the molecular formula C6H7NaS and a molecular weight of 134.18 g/mol. Its IUPAC name is sodium (3Z)-hexa-1,3,5-triene-2-thiolate.
| Compound Name | sodium (3Z)-hexa-1,3,5-triene-2-thiolate |
|---|---|
| PubChem CID | 145184623 |
| Molecular Formula | C6H7NaS |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.02 |
| IUPAC Name | sodium (3Z)-hexa-1,3,5-triene-2-thiolate |
| SMILES | C=C/C=C\C(=C)[S-].[Na+] |
| InChI | InChI=1S/C6H8S.Na/c1-3-4-5-6(2)7;/h3-5,7H,1-2H2;/q;+1/p-1/b5-4-; |
| InChIKey | MBUIWQCVPNOTON-MKWAYWHRSA-M |
| XLogP | -1.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|