C21H32O — CID 143661428
ethane;(3E,6E,7Z)-6-ethylidene-5-ethynyl-4-[(Z)-prop-1-enyl]deca-1,3,7,9-tetraen-5-ol (PubChem CID 143661428) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is ethane;(3E,6E,7Z)-6-ethylidene-5-ethynyl-4-[(Z)-prop-1-enyl]deca-1,3,7,9-tetraen-5-ol.
| Compound Name | ethane;(3E,6E,7Z)-6-ethylidene-5-ethynyl-4-[(Z)-prop-1-enyl]deca-1,3,7,9-tetraen-5-ol |
|---|---|
| PubChem CID | 143661428 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | ethane;(3E,6E,7Z)-6-ethylidene-5-ethynyl-4-[(Z)-prop-1-enyl]deca-1,3,7,9-tetraen-5-ol |
| SMILES | C#CC(O)(C(/C=C\C=C)=C/C)C(/C=C\C)=C/C=C.CC.CC |
| InChI | InChI=1S/C17H20O.2C2H6/c1-6-11-14-15(9-4)17(18,10-5)16(12-7-2)13-8-3;2*1-2/h5-9,11-14,18H,1-2H2,3-4H3;2*1-2H3/b13-8-,14-11-,15-9+,16-12+;; |
| InChIKey | VVCHTZLFKSPAAK-NILVURIQSA-N |
| XLogP | 5.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|