C11H16 — CID 143837264
ethane;(3Z,5E)-5-ethynylhepta-1,3,5-triene (PubChem CID 143837264) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is ethane;(3Z,5E)-5-ethynylhepta-1,3,5-triene.
| Compound Name | ethane;(3Z,5E)-5-ethynylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143837264 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | ethane;(3Z,5E)-5-ethynylhepta-1,3,5-triene |
| SMILES | C#CC(/C=C\C=C)=C/C.CC |
| InChI | InChI=1S/C9H10.C2H6/c1-4-7-8-9(5-2)6-3;1-2/h2,4,6-8H,1H2,3H3;1-2H3/b8-7-,9-6-; |
| InChIKey | RZBITONPTRFEJH-RTJPRTBYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|