C21H32 — CID 144946763
(3Z,5E,10E,11Z)-5,10-di(ethylidene)trideca-1,3,6,11-tetraen-8-yne;ethane (PubChem CID 144946763) has the molecular formula C21H32 and a molecular weight of 284.49 g/mol. Its IUPAC name is (3Z,5E,10E,11Z)-5,10-di(ethylidene)trideca-1,3,6,11-tetraen-8-yne;ethane.
| Compound Name | (3Z,5E,10E,11Z)-5,10-di(ethylidene)trideca-1,3,6,11-tetraen-8-yne;ethane |
|---|---|
| PubChem CID | 144946763 |
| Molecular Formula | C21H32 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | (3Z,5E,10E,11Z)-5,10-di(ethylidene)trideca-1,3,6,11-tetraen-8-yne;ethane |
| SMILES | C=C/C=C\C(C=CC#CC(/C=C\C)=C/C)=C/C.CC.CC |
| InChI | InChI=1S/C17H20.2C2H6/c1-5-9-13-17(8-4)15-11-10-14-16(7-3)12-6-2;2*1-2/h5-9,11-13,15H,1H2,2-4H3;2*1-2H3/b12-6-,13-9-,15-11?,16-7+,17-8+;; |
| InChIKey | DGWIHZSCRMGGCU-KZNUPIBVSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|