C11H10N2 — CID 145486678
2-[(2E,3Z)-2-ethylidenehexa-3,5-dienylidene]propanedinitrile (PubChem CID 145486678) has the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-[(2E,3Z)-2-ethylidenehexa-3,5-dienylidene]propanedinitrile.
| Compound Name | 2-[(2E,3Z)-2-ethylidenehexa-3,5-dienylidene]propanedinitrile |
|---|---|
| PubChem CID | 145486678 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2-[(2E,3Z)-2-ethylidenehexa-3,5-dienylidene]propanedinitrile |
| SMILES | C=C/C=C\C(C=C(C#N)C#N)=C/C |
| InChI | InChI=1S/C11H10N2/c1-3-5-6-10(4-2)7-11(8-12)9-13/h3-7H,1H2,2H3/b6-5-,10-4+ |
| InChIKey | QDBSTJGEFFPKCY-QYONPMAVSA-N |
| XLogP | 2.65 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|