C13H21NO — CID 142901922
ethane;(2E,4E,5Z)-4-ethylidene-N-methylocta-2,5,7-trienamide (PubChem CID 142901922) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is ethane;(2E,4E,5Z)-4-ethylidene-N-methylocta-2,5,7-trienamide.
| Compound Name | ethane;(2E,4E,5Z)-4-ethylidene-N-methylocta-2,5,7-trienamide |
|---|---|
| PubChem CID | 142901922 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | ethane;(2E,4E,5Z)-4-ethylidene-N-methylocta-2,5,7-trienamide |
| SMILES | C=C/C=C\C(\C=C\C(=O)NC)=C/C.CC |
| InChI | InChI=1S/C11H15NO.C2H6/c1-4-6-7-10(5-2)8-9-11(13)12-3;1-2/h4-9H,1H2,2-3H3,(H,12,13);1-2H3/b7-6-,9-8+,10-5+; |
| InChIKey | OFPLISWKYKHNHU-BNBYKLJBSA-N |
| XLogP | 3.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|