C8H12N2O2 — CID 102438921
(2Z,4Z)-N,N'-dimethylhexa-2,4-dienediamide (PubChem CID 102438921) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is (2Z,4Z)-N,N'-dimethylhexa-2,4-dienediamide.
| Compound Name | (2Z,4Z)-N,N'-dimethylhexa-2,4-dienediamide |
|---|---|
| PubChem CID | 102438921 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | (2Z,4Z)-N,N'-dimethylhexa-2,4-dienediamide |
| SMILES | CNC(=O)/C=C\C=C/C(=O)NC |
| InChI | InChI=1S/C8H12N2O2/c1-9-7(11)5-3-4-6-8(12)10-2/h3-6H,1-2H3,(H,9,11)(H,10,12)/b5-3-,6-4- |
| InChIKey | DZKSPASFSHUXQK-GLIMQPGKSA-N |
| XLogP | -0.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|