About N-methyl-3-sulfanylprop-2-enamide;silver
N-methyl-3-sulfanylprop-2-enamide;silver (PubChem CID 173393261) has the molecular formula C4H7AgNOS
and a molecular weight of 225.04 g/mol. Its IUPAC name is N-methyl-3-sulfanylprop-2-enamide;silver.
Molecular Properties
| Compound Name | N-methyl-3-sulfanylprop-2-enamide;silver |
| PubChem CID | 173393261 |
| Molecular Formula | C4H7AgNOS |
| Molecular Weight | 225.04 g/mol |
| Exact Mass | 223.93 |
| IUPAC Name | N-methyl-3-sulfanylprop-2-enamide;silver |
| SMILES | CNC(=O)C=CS.[Ag] |
| InChI | InChI=1S/C4H7NOS.Ag/c1-5-4(6)2-3-7;/h2-3,7H,1H3,(H,5,6); |
| InChIKey | XUJBYYKHJISAII-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.04 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3-sulfanylprop-2-enamide;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-sulfanylprop-2-enamide;silver?
The IUPAC name of N-methyl-3-sulfanylprop-2-enamide;silver (CID 173393261) is N-methyl-3-sulfanylprop-2-enamide;silver.
What is the SMILES notation for N-methyl-3-sulfanylprop-2-enamide;silver?
The canonical SMILES for N-methyl-3-sulfanylprop-2-enamide;silver is CNC(=O)C=CS.[Ag].
What is the InChIKey of N-methyl-3-sulfanylprop-2-enamide;silver?
The InChIKey is XUJBYYKHJISAII-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NOS.Ag/c1-5-4(6)2-3-7;/h2-3,7H,1H3,(H,5,6);.
What are the key properties of N-methyl-3-sulfanylprop-2-enamide;silver?
N-methyl-3-sulfanylprop-2-enamide;silver has a molecular weight of 225.04 g/mol, XLogP of 0.17, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-sulfanylprop-2-enamide;silver is sourced from PubChem (CID 173393261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).