C7H10OS — CID 145478099
(1Z,3E)-3-methoxyhexa-1,3,5-triene-1-thiol (PubChem CID 145478099) has the molecular formula C7H10OS and a molecular weight of 142.22 g/mol. Its IUPAC name is (1Z,3E)-3-methoxyhexa-1,3,5-triene-1-thiol.
| Compound Name | (1Z,3E)-3-methoxyhexa-1,3,5-triene-1-thiol |
|---|---|
| PubChem CID | 145478099 |
| Molecular Formula | C7H10OS |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | (1Z,3E)-3-methoxyhexa-1,3,5-triene-1-thiol |
| SMILES | C=C/C=C(\C=C/S)OC |
| InChI | InChI=1S/C7H10OS/c1-3-4-7(8-2)5-6-9/h3-6,9H,1H2,2H3/b6-5-,7-4+ |
| InChIKey | NOWNEGLPPNBZKV-IUQJDUBZSA-N |
| XLogP | 2.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|