C11H16O3 — CID 143061630
methyl (3E,5E)-5-methoxy-3-methylocta-3,5,7-trienoate (PubChem CID 143061630) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is methyl (3E,5E)-5-methoxy-3-methylocta-3,5,7-trienoate.
| Compound Name | methyl (3E,5E)-5-methoxy-3-methylocta-3,5,7-trienoate |
|---|---|
| PubChem CID | 143061630 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | methyl (3E,5E)-5-methoxy-3-methylocta-3,5,7-trienoate |
| SMILES | C=C/C=C(\C=C(/C)CC(=O)OC)OC |
| InChI | InChI=1S/C11H16O3/c1-5-6-10(13-3)7-9(2)8-11(12)14-4/h5-7H,1,8H2,2-4H3/b9-7+,10-6+ |
| InChIKey | AKCARHGMUOVDSM-IDXDHNASSA-N |
| XLogP | 2.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|