C14H18O2 — CID 89066005
(3Z,5Z,7E,9Z)-2,8-dimethoxydodeca-1,3,5,7,9,11-hexaene (PubChem CID 89066005) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (3Z,5Z,7E,9Z)-2,8-dimethoxydodeca-1,3,5,7,9,11-hexaene.
| Compound Name | (3Z,5Z,7E,9Z)-2,8-dimethoxydodeca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 89066005 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (3Z,5Z,7E,9Z)-2,8-dimethoxydodeca-1,3,5,7,9,11-hexaene |
| SMILES | C=C/C=C\C(=C/C=C\C=C/C(=C)OC)OC |
| InChI | InChI=1S/C14H18O2/c1-5-6-11-14(16-4)12-9-7-8-10-13(2)15-3/h5-12H,1-2H2,3-4H3/b9-7-,10-8-,11-6-,14-12+ |
| InChIKey | UTKGZFFVHLKTKS-GVULUDIUSA-N |
| XLogP | 3.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|