C13H20O — CID 130337292
(3E,5Z)-4-tert-butyl-2-methoxyocta-1,3,5,7-tetraene (PubChem CID 130337292) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (3E,5Z)-4-tert-butyl-2-methoxyocta-1,3,5,7-tetraene.
| Compound Name | (3E,5Z)-4-tert-butyl-2-methoxyocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 130337292 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (3E,5Z)-4-tert-butyl-2-methoxyocta-1,3,5,7-tetraene |
| SMILES | C=C/C=C\C(=C/C(=C)OC)C(C)(C)C |
| InChI | InChI=1S/C13H20O/c1-7-8-9-12(13(3,4)5)10-11(2)14-6/h7-10H,1-2H2,3-6H3/b9-8-,12-10+ |
| InChIKey | JFMOKVNZEXMKMP-LVQHWDRTSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|