C9H11ClO — CID 89328698
(3E,5Z)-2-chloro-4-methoxyocta-1,3,5,7-tetraene (PubChem CID 89328698) has the molecular formula C9H11ClO and a molecular weight of 170.64 g/mol. Its IUPAC name is (3E,5Z)-2-chloro-4-methoxyocta-1,3,5,7-tetraene.
| Compound Name | (3E,5Z)-2-chloro-4-methoxyocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 89328698 |
| Molecular Formula | C9H11ClO |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | (3E,5Z)-2-chloro-4-methoxyocta-1,3,5,7-tetraene |
| SMILES | C=C/C=C\C(=C/C(=C)Cl)OC |
| InChI | InChI=1S/C9H11ClO/c1-4-5-6-9(11-3)7-8(2)10/h4-7H,1-2H2,3H3/b6-5-,9-7+ |
| InChIKey | HIFCDJFFIXRMHG-BZWSEGBZSA-N |
| XLogP | 3.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|