C16H22O2 — CID 155039162
(3E,5E,7E,9E)-3,10-dimethoxy-6,7-dimethyldodeca-1,3,5,7,9,11-hexaene (PubChem CID 155039162) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (3E,5E,7E,9E)-3,10-dimethoxy-6,7-dimethyldodeca-1,3,5,7,9,11-hexaene.
| Compound Name | (3E,5E,7E,9E)-3,10-dimethoxy-6,7-dimethyldodeca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 155039162 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (3E,5E,7E,9E)-3,10-dimethoxy-6,7-dimethyldodeca-1,3,5,7,9,11-hexaene |
| SMILES | C=C/C(=C\C=C(C)\C(C)=C\C=C(/C=C)OC)OC |
| InChI | InChI=1S/C16H22O2/c1-7-15(17-5)11-9-13(3)14(4)10-12-16(8-2)18-6/h7-12H,1-2H2,3-6H3/b13-9+,14-10+,15-11+,16-12+ |
| InChIKey | AFLWWKQGCOTBLO-KUWVSJDVSA-N |
| XLogP | 4.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|