C12H18O3S — CID 143619036
4-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]sulfanylbutanoic acid (PubChem CID 143619036) has the molecular formula C12H18O3S and a molecular weight of 242.34 g/mol. Its IUPAC name is 4-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]sulfanylbutanoic acid.
| Compound Name | 4-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 143619036 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 4-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]sulfanylbutanoic acid |
| SMILES | C=C/C(=C\C=C(/C)SCCCC(=O)O)OC |
| InChI | InChI=1S/C12H18O3S/c1-4-11(15-3)8-7-10(2)16-9-5-6-12(13)14/h4,7-8H,1,5-6,9H2,2-3H3,(H,13,14)/b10-7+,11-8+ |
| InChIKey | WSWHVLMUSUWHCB-AMMQDNIMSA-N |
| XLogP | 3.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|