C15H28O9 — CID 174398142
hexanedioic acid;2-(hydroxymethyl)-2-methylpropane-1,3-diol;methyl prop-2-enoate (PubChem CID 174398142) has the molecular formula C15H28O9 and a molecular weight of 352.38 g/mol. Its IUPAC name is hexanedioic acid;2-(hydroxymethyl)-2-methylpropane-1,3-diol;methyl prop-2-enoate.
| Compound Name | hexanedioic acid;2-(hydroxymethyl)-2-methylpropane-1,3-diol;methyl prop-2-enoate |
|---|---|
| PubChem CID | 174398142 |
| Molecular Formula | C15H28O9 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | hexanedioic acid;2-(hydroxymethyl)-2-methylpropane-1,3-diol;methyl prop-2-enoate |
| SMILES | C=CC(=O)OC.CC(CO)(CO)CO.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C6H10O4.C5H12O3.C4H6O2/c7-5(8)3-1-2-4-6(9)10;1-5(2-6,3-7)4-8;1-3-4(5)6-2/h1-4H2,(H,7,8)(H,9,10);6-8H,2-4H2,1H3;3H,1H2,2H3 |
| InChIKey | HETDPYWRMISRHQ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|