C14H25NNaO3 — CID 131887558
CID 131887558 (PubChem CID 131887558) has the molecular formula C14H25NNaO3 and a molecular weight of 278.35 g/mol.
| Compound Name | CID 131887558 |
|---|---|
| PubChem CID | 131887558 |
| Molecular Formula | C14H25NNaO3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | — |
| SMILES | C=CC(=O)NCCCCCCCCCCC(=O)O.[Na] |
| InChI | InChI=1S/C14H25NO3.Na/c1-2-13(16)15-12-10-8-6-4-3-5-7-9-11-14(17)18;/h2H,1,3-12H2,(H,15,16)(H,17,18); |
| InChIKey | YIEDPOUBIHOQDD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|