C21H23NO2 — CID 143692858
(2E,4E)-5-methoxy-2-methyl-1-(N-phenylanilino)hepta-2,4,6-trien-1-ol (PubChem CID 143692858) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (2E,4E)-5-methoxy-2-methyl-1-(N-phenylanilino)hepta-2,4,6-trien-1-ol.
| Compound Name | (2E,4E)-5-methoxy-2-methyl-1-(N-phenylanilino)hepta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 143692858 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (2E,4E)-5-methoxy-2-methyl-1-(N-phenylanilino)hepta-2,4,6-trien-1-ol |
| SMILES | C=C/C(=C\C=C(/C)C(O)N(c1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C21H23NO2/c1-4-20(24-3)16-15-17(2)21(23)22(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h4-16,21,23H,1H2,2-3H3/b17-15+,20-16+ |
| InChIKey | POKVKFVEDZTREH-XBTKLTQZSA-N |
| XLogP | 4.81 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|